Coordination properties of aminophosphine with first row transition metal nitrosyl complexes.
| dc.contributor.advisor | Roustan, J. L., | |
| dc.contributor.author | Ansari, Nasrin. | |
| dc.date.accessioned | 2009-03-23T14:15:38Z | |
| dc.date.available | 2009-03-23T14:15:38Z | |
| dc.date.created | 1994 | |
| dc.date.issued | 1994 | |
| dc.degree.level | Doctoral | |
| dc.description.abstract | The synthesis of the new thermolabile ironnitrosylhydride complex FeH(NO)(CO)(dppf) is reported. (dppf = 1,1$\sp\prime$-bisdiphenyl phosphino-ferrocene). The facile decomposition of FeH(NO)(CO)(dppf) is interpreted in terms of a homolysis of the Fe-H bond and of a nitrosyl transfer reaction. The synthesis of the structurally characterized iron complex Fe(O=PPh$\sb2$(2-Py))$\sb3\sp2\sp+\cdot$2BF$\sb4\sp-$, by the reaction of Fe(NO)$\sb2$(THF)$\sb2\sp+$ with PPh$\sb2$(2-Py) is described. The proposed mechanism for the formation of Fe(O=PPh$\sb2$(2-Py))$\sb3\sp2\sp+\cdot$2BF$\sb4\sp-$ involves a combination of disproportionation and oxygen transfer reactions. This dipositive iron complex is the first example of a first row transition metal chelated by the oxide of diphenyl(2-pyridyl)phosphines. The synthesis and the reactivity of the cobaltdinitrosyl monometallic Co(NO$\sb2$(PPh$\sb2(2$-Py))$\sb2\sp+\cdot$BF$\sb4\sp-$, Co(NO)$\sb2$(Py)$\sb2\sp+\cdot$BF$\sb4\sp-$, Co(NO)$\sb2$(Py)$\sb2\sp+\cdot$BPh$\sb4\sp-$ and bimetallic Co$\sb2$(NO)$\sb3$(PPh$\sb2$(2-Py))$\sb2\sp+$ -BPh$\sb4\sp-$ complexes are reported. The single crystal X-ray diffraction study of Co(NO)$\sb2$(PPh$\sb2$(2-Py))$\sb2\sp+$BF$\sb4\sp-$ shows that the aminophosphine ligands are co-ordinated through their P-donor sites. In solution, Co(NO)$\sb2$(Py)$\sb2\sp+$BF$\sb4\sp-$ was stable whereas, Co(NO)$\sb2$(Py)$\sb2\sp+$BPh$\sb4\sp-$ decomposed rapidly. The structural study of Co(NO)$\sb2$(Py)$\sb2\sp+$BF$\sb4\sp-$ has led to the proposal of a new theoretical model in which the non-bonded repulsions between the NO and L ligands of the M(NO)(L) moieties provide the most influential factor for fixing the value of the (O)N-M-N(O) angle. The structurally characterized Co$\sb2$(NO)$\sb3$(PPh$\sb2$(2-Py))$\sb2\sp+$ -BPh$\sb4\sp-$ complex is the first example of a bimetallic containing two metal-metal bonded first row transition metals with diphenyl(2-pyridyl)phosphine as a bridging ligand. It is also the first example of a Co$\sb2$(NO)$\sb3\sp+$ bimetallic core stabilized by two diphenyl(2-pyridyl)phosphine ligands coordinated by the P and N donor sites of the ligands arranged in a head-to-head fashion. | |
| dc.format.extent | 279 p. | |
| dc.identifier.citation | Source: Dissertation Abstracts International, Volume: 56-11, Section: B, page: 6113. | |
| dc.identifier.isbn | 9780612004443 | |
| dc.identifier.uri | http://hdl.handle.net/10393/6862 | |
| dc.identifier.uri | http://dx.doi.org/10.20381/ruor-11490 | |
| dc.publisher | University of Ottawa (Canada) | |
| dc.subject.classification | Chemistry, Organic. | |
| dc.title | Coordination properties of aminophosphine with first row transition metal nitrosyl complexes. | |
| dc.type | Thesis |
Files
Original bundle
1 - 1 of 1
